C16H27F3N2O3 — CID 42611836
tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-[(prop-2-enylamino)methyl]propanoyl]amino]butanoate (PubChem CID 42611836) has the molecular formula C16H27F3N2O3 and a molecular weight of 352.40 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-[(prop-2-enylamino)methyl]propanoyl]amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-[(prop-2-enylamino)methyl]propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 42611836 |
| Molecular Formula | C16H27F3N2O3 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-[(prop-2-enylamino)methyl]propanoyl]amino]butanoate |
| SMILES | C=CCNCC(C(=O)N[C@H](C(=O)OC(C)(C)C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H27F3N2O3/c1-7-8-20-9-11(16(17,18)19)13(22)21-12(10(2)3)14(23)24-15(4,5)6/h7,10-12,20H,1,8-9H2,2-6H3,(H,21,22)/t11?,12-/m0/s1 |
| InChIKey | CXIDSUYJZSFHCX-KIYNQFGBSA-N |
| XLogP | 2.42 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|