C46H24F6 — CID 42611891
5,10-diphenyl-1,6-bis(2-phenylethynyl)-3,8-bis(trifluoromethyl)indeno[2,1-a]indene (PubChem CID 42611891) has the molecular formula C46H24F6 and a molecular weight of 690.69 g/mol. Its IUPAC name is 5,10-diphenyl-1,6-bis(2-phenylethynyl)-3,8-bis(trifluoromethyl)indeno[2,1-a]indene.
| Compound Name | 5,10-diphenyl-1,6-bis(2-phenylethynyl)-3,8-bis(trifluoromethyl)indeno[2,1-a]indene |
|---|---|
| PubChem CID | 42611891 |
| Molecular Formula | C46H24F6 |
| Molecular Weight | 690.69 g/mol |
| Exact Mass | 690.18 |
| IUPAC Name | 5,10-diphenyl-1,6-bis(2-phenylethynyl)-3,8-bis(trifluoromethyl)indeno[2,1-a]indene |
| SMILES | FC(F)(F)c1cc(C#Cc2ccccc2)c2c(c1)=C1C(=c3cc(C(F)(F)F)cc(C#Cc4ccccc4)c3=C1c1ccccc1)C=2c1ccccc1 |
| InChI | InChI=1S/C46H24F6/c47-45(48,49)35-25-33(23-21-29-13-5-1-6-14-29)39-37(27-35)43-42(32-19-11-4-12-20-32)40-34(24-22-30-15-7-2-8-16-30)26-36(46(50,51)52)28-38(40)44(43)41(39)31-17-9-3-10-18-31/h1-20,25-28H |
| InChIKey | QSTMJXZMDIWKHF-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.69 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|