C20H34O2Si — CID 42612110
(1S,3S,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-one (PubChem CID 42612110) has the molecular formula C20H34O2Si and a molecular weight of 334.58 g/mol. Its IUPAC name is (1S,3S,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-one.
| Compound Name | (1S,3S,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-one |
|---|---|
| PubChem CID | 42612110 |
| Molecular Formula | C20H34O2Si |
| Molecular Weight | 334.58 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | (1S,3S,7S,8R,11S)-6-[tert-butyl(dimethyl)silyl]oxy-9,9-dimethyltetracyclo[6.4.0.01,11.03,7]dodecan-2-one |
| SMILES | CC1(C)C[C@H]2C[C@]23C(=O)[C@H]2CCC(O[Si](C)(C)C(C)(C)C)[C@H]2[C@H]13 |
| InChI | InChI=1S/C20H34O2Si/c1-18(2,3)23(6,7)22-14-9-8-13-15(14)16-19(4,5)10-12-11-20(12,16)17(13)21/h12-16H,8-11H2,1-7H3/t12-,13-,14?,15-,16+,20-/m0/s1 |
| InChIKey | CVZSVBYSVSOBHC-IGYJYIILSA-N |
| XLogP | 5.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|