C14H21F3N2O4 — CID 42612159
tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-(isocyanatomethyl)propanoyl]amino]butanoate (PubChem CID 42612159) has the molecular formula C14H21F3N2O4 and a molecular weight of 338.33 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-(isocyanatomethyl)propanoyl]amino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-(isocyanatomethyl)propanoyl]amino]butanoate |
|---|---|
| PubChem CID | 42612159 |
| Molecular Formula | C14H21F3N2O4 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[[(2S)-3,3,3-trifluoro-2-(isocyanatomethyl)propanoyl]amino]butanoate |
| SMILES | CC(C)[C@H](NC(=O)[C@H](CN=C=O)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21F3N2O4/c1-8(2)10(12(22)23-13(3,4)5)19-11(21)9(6-18-7-20)14(15,16)17/h8-10H,6H2,1-5H3,(H,19,21)/t9-,10-/m0/s1 |
| InChIKey | WSRVBGCRAUKRFC-UWVGGRQHSA-N |
| XLogP | 1.98 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|