C16H20O6 — CID 42612201
methyl (Z)-5-(2,5-diethoxyphenyl)-5-hydroxy-3-oxopent-4-enoate (PubChem CID 42612201) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is methyl (Z)-5-(2,5-diethoxyphenyl)-5-hydroxy-3-oxopent-4-enoate.
| Compound Name | methyl (Z)-5-(2,5-diethoxyphenyl)-5-hydroxy-3-oxopent-4-enoate |
|---|---|
| PubChem CID | 42612201 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | methyl (Z)-5-(2,5-diethoxyphenyl)-5-hydroxy-3-oxopent-4-enoate |
| SMILES | CCOc1ccc(OCC)c(/C(O)=C/C(=O)CC(=O)OC)c1 |
| InChI | InChI=1S/C16H20O6/c1-4-21-12-6-7-15(22-5-2)13(10-12)14(18)8-11(17)9-16(19)20-3/h6-8,10,18H,4-5,9H2,1-3H3/b14-8- |
| InChIKey | GFWPCDAXPOOYSP-ZSOIEALJSA-N |
| XLogP | 2.52 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|