C27H34N2O5Si — CID 42612330
methyl (3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-nitroprop-2-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 42612330) has the molecular formula C27H34N2O5Si and a molecular weight of 494.66 g/mol. Its IUPAC name is methyl (3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-nitroprop-2-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | methyl (3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-nitroprop-2-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 42612330 |
| Molecular Formula | C27H34N2O5Si |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | methyl (3R,6R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(E)-3-nitroprop-2-enyl]-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | COC(=O)N1C[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@H]1C/C=C/[N+](=O)[O-] |
| InChI | InChI=1S/C27H34N2O5Si/c1-27(2,3)35(24-13-7-5-8-14-24,25-15-9-6-10-16-25)34-21-22-17-18-23(12-11-19-29(31)32)28(20-22)26(30)33-4/h5-11,13-19,22-23H,12,20-21H2,1-4H3/b19-11+/t22-,23-/m1/s1 |
| InChIKey | CXRJSAJIIGUYTC-OTEUQYBSSA-N |
| XLogP | 4.37 |
| TPSA | 81.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|