C27H29NO9S — CID 42612381
[3-acetyl-7,8,9-trimethoxy-5-(4-methylphenyl)sulfonyloxy-1,2-dihydrobenzo[e]indol-1-yl]methyl acetate (PubChem CID 42612381) has the molecular formula C27H29NO9S and a molecular weight of 543.59 g/mol. Its IUPAC name is [3-acetyl-7,8,9-trimethoxy-5-(4-methylphenyl)sulfonyloxy-1,2-dihydrobenzo[e]indol-1-yl]methyl acetate.
| Compound Name | [3-acetyl-7,8,9-trimethoxy-5-(4-methylphenyl)sulfonyloxy-1,2-dihydrobenzo[e]indol-1-yl]methyl acetate |
|---|---|
| PubChem CID | 42612381 |
| Molecular Formula | C27H29NO9S |
| Molecular Weight | 543.59 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | [3-acetyl-7,8,9-trimethoxy-5-(4-methylphenyl)sulfonyloxy-1,2-dihydrobenzo[e]indol-1-yl]methyl acetate |
| SMILES | COc1cc2c(OS(=O)(=O)c3ccc(C)cc3)cc3c(c2c(OC)c1OC)C(COC(C)=O)CN3C(C)=O |
| InChI | InChI=1S/C27H29NO9S/c1-15-7-9-19(10-8-15)38(31,32)37-22-12-21-24(18(14-36-17(3)30)13-28(21)16(2)29)25-20(22)11-23(33-4)26(34-5)27(25)35-6/h7-12,18H,13-14H2,1-6H3 |
| InChIKey | LPQWQICLPCFDOS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|