About (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol
(E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol (PubChem CID 42612527) has the molecular formula C12H24O3
and a molecular weight of 216.32 g/mol. Its IUPAC name is (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol.
Molecular Properties
| Compound Name | (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol |
| PubChem CID | 42612527 |
| Molecular Formula | C12H24O3 |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.17 |
| IUPAC Name | (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol |
| SMILES | CCC(CC)O[C@@H](/C=C/CCCO)CO |
| InChI | InChI=1S/C12H24O3/c1-3-11(4-2)15-12(10-14)8-6-5-7-9-13/h6,8,11-14H,3-5,7,9-10H2,1-2H3/b8-6+/t12-/m0/s1 |
| InChIKey | LPIJCRLQCPOFDV-WMADIVHISA-N |
| XLogP | 1.88 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol?
The IUPAC name of (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol (CID 42612527) is (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol.
What is the SMILES notation for (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol?
The canonical SMILES for (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol is CCC(CC)O[C@@H](/C=C/CCCO)CO.
What is the InChIKey of (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol?
The InChIKey is LPIJCRLQCPOFDV-WMADIVHISA-N. The full InChI is InChI=1S/C12H24O3/c1-3-11(4-2)15-12(10-14)8-6-5-7-9-13/h6,8,11-14H,3-5,7,9-10H2,1-2H3/b8-6+/t12-/m0/s1.
What are the key properties of (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol?
(E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol has a molecular weight of 216.32 g/mol, XLogP of 1.88, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E,2S)-2-pentan-3-yloxyhept-3-ene-1,7-diol is sourced from PubChem (CID 42612527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).