C18H12ClN — CID 42612557
4-(4-chlorophenyl)pyrrolo[1,2-a]quinoline (PubChem CID 42612557) has the molecular formula C18H12ClN and a molecular weight of 277.75 g/mol. Its IUPAC name is 4-(4-chlorophenyl)pyrrolo[1,2-a]quinoline.
| Compound Name | 4-(4-chlorophenyl)pyrrolo[1,2-a]quinoline |
|---|---|
| PubChem CID | 42612557 |
| Molecular Formula | C18H12ClN |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 4-(4-chlorophenyl)pyrrolo[1,2-a]quinoline |
| SMILES | Clc1ccc(-c2cc3ccccc3n3cccc23)cc1 |
| InChI | InChI=1S/C18H12ClN/c19-15-9-7-13(8-10-15)16-12-14-4-1-2-5-17(14)20-11-3-6-18(16)20/h1-12H |
| InChIKey | XPOSSNXEWYRGSC-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 4.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |