C23H26O4S2 — CID 42612768
8-(1,3-dithiolan-2-ylidene)-11-(4-methoxyphenyl)-3,3-dimethylspiro[5.5]undecane-1,5,9-trione (PubChem CID 42612768) has the molecular formula C23H26O4S2 and a molecular weight of 430.59 g/mol. Its IUPAC name is 8-(1,3-dithiolan-2-ylidene)-11-(4-methoxyphenyl)-3,3-dimethylspiro[5.5]undecane-1,5,9-trione.
| Compound Name | 8-(1,3-dithiolan-2-ylidene)-11-(4-methoxyphenyl)-3,3-dimethylspiro[5.5]undecane-1,5,9-trione |
|---|---|
| PubChem CID | 42612768 |
| Molecular Formula | C23H26O4S2 |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 8-(1,3-dithiolan-2-ylidene)-11-(4-methoxyphenyl)-3,3-dimethylspiro[5.5]undecane-1,5,9-trione |
| SMILES | COc1ccc(C2CC(=O)C(=C3SCCS3)CC23C(=O)CC(C)(C)CC3=O)cc1 |
| InChI | InChI=1S/C23H26O4S2/c1-22(2)12-19(25)23(20(26)13-22)11-16(21-28-8-9-29-21)18(24)10-17(23)14-4-6-15(27-3)7-5-14/h4-7,17H,8-13H2,1-3H3 |
| InChIKey | AHHOSFHSKRVPOG-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|