C6H13NO4 — CID 42612828
(1R,2S,3S,4S,5S)-5-aminocyclohexane-1,2,3,4-tetrol (PubChem CID 42612828) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is (1R,2S,3S,4S,5S)-5-aminocyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2S,3S,4S,5S)-5-aminocyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 42612828 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | (1R,2S,3S,4S,5S)-5-aminocyclohexane-1,2,3,4-tetrol |
| SMILES | N[C@H]1C[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C6H13NO4/c7-2-1-3(8)5(10)6(11)4(2)9/h2-6,8-11H,1,7H2/t2-,3+,4-,5-,6-/m0/s1 |
| InChIKey | QXQNRSUOYNMXDL-GNFDWLABSA-N |
| XLogP | -2.84 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |