C14H24FN3O2 — CID 42613993
(3S,5S)-5-[(1S,3S)-1-azido-3-(fluoromethyl)-4-methylpentyl]-3-propan-2-yloxolan-2-one (PubChem CID 42613993) has the molecular formula C14H24FN3O2 and a molecular weight of 285.36 g/mol. Its IUPAC name is (3S,5S)-5-[(1S,3S)-1-azido-3-(fluoromethyl)-4-methylpentyl]-3-propan-2-yloxolan-2-one.
| Compound Name | (3S,5S)-5-[(1S,3S)-1-azido-3-(fluoromethyl)-4-methylpentyl]-3-propan-2-yloxolan-2-one |
|---|---|
| PubChem CID | 42613993 |
| Molecular Formula | C14H24FN3O2 |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | (3S,5S)-5-[(1S,3S)-1-azido-3-(fluoromethyl)-4-methylpentyl]-3-propan-2-yloxolan-2-one |
| SMILES | CC(C)[C@@H](CF)C[C@H](N=[N+]=[N-])[C@@H]1C[C@@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C14H24FN3O2/c1-8(2)10(7-15)5-12(17-18-16)13-6-11(9(3)4)14(19)20-13/h8-13H,5-7H2,1-4H3/t10-,11+,12+,13+/m1/s1 |
| InChIKey | MMCCRNBCLIVIQN-VOAKCMCISA-N |
| XLogP | 3.88 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|