C24H21ClN2O3 — CID 42614024
1-[3-[[2-(4-chlorophenoxy)anilino]methyl]-5-methoxyindol-1-yl]ethanone (PubChem CID 42614024) has the molecular formula C24H21ClN2O3 and a molecular weight of 420.90 g/mol. Its IUPAC name is 1-[3-[[2-(4-chlorophenoxy)anilino]methyl]-5-methoxyindol-1-yl]ethanone.
| Compound Name | 1-[3-[[2-(4-chlorophenoxy)anilino]methyl]-5-methoxyindol-1-yl]ethanone |
|---|---|
| PubChem CID | 42614024 |
| Molecular Formula | C24H21ClN2O3 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | 1-[3-[[2-(4-chlorophenoxy)anilino]methyl]-5-methoxyindol-1-yl]ethanone |
| SMILES | COc1ccc2c(c1)c(CNc1ccccc1Oc1ccc(Cl)cc1)cn2C(C)=O |
| InChI | InChI=1S/C24H21ClN2O3/c1-16(28)27-15-17(21-13-20(29-2)11-12-23(21)27)14-26-22-5-3-4-6-24(22)30-19-9-7-18(25)8-10-19/h3-13,15,26H,14H2,1-2H3 |
| InChIKey | KBLCWHGSNHTNLA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |