C16H13N — CID 42614042
tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-amine (PubChem CID 42614042) has the molecular formula C16H13N and a molecular weight of 219.29 g/mol. Its IUPAC name is tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-amine.
| Compound Name | tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-amine |
|---|---|
| PubChem CID | 42614042 |
| Molecular Formula | C16H13N |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | tricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-amine |
| SMILES | NC1Cc2ccccc2C#Cc2ccccc21 |
| InChI | InChI=1S/C16H13N/c17-16-11-14-7-2-1-5-12(14)9-10-13-6-3-4-8-15(13)16/h1-8,16H,11,17H2 |
| InChIKey | ZTDVVCHUSBTDTL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|