C6H13NO — CID 42614402
trans-(1S,3S)-3-(aminomethyl)cyclopentan-1-ol (PubChem CID 42614402) has the molecular formula C6H13NO and a molecular weight of 115.18 g/mol. Its IUPAC name is trans-(1S,3S)-3-(aminomethyl)cyclopentan-1-ol.
| Compound Name | trans-(1S,3S)-3-(aminomethyl)cyclopentan-1-ol |
|---|---|
| PubChem CID | 42614402 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | trans-(1S,3S)-3-(aminomethyl)cyclopentan-1-ol |
| SMILES | NC[C@H]1CC[C@H](O)C1 |
| InChI | InChI=1S/C6H13NO/c7-4-5-1-2-6(8)3-5/h5-6,8H,1-4,7H2/t5-,6-/m0/s1 |
| InChIKey | NUBNZASXRSXFRW-WDSKDSINSA-N |
| XLogP | 0.11 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |