About methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride
methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride (PubChem CID 42614494) has the molecular formula C9H14Cl2N2O2
and a molecular weight of 253.13 g/mol. Its IUPAC name is methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride.
Molecular Properties
| Compound Name | methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride |
| PubChem CID | 42614494 |
| Molecular Formula | C9H14Cl2N2O2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride |
| SMILES | COC(=O)CC(N)c1ccccn1.Cl.Cl |
| InChI | InChI=1S/C9H12N2O2.2ClH/c1-13-9(12)6-7(10)8-4-2-3-5-11-8;;/h2-5,7H,6,10H2,1H3;2*1H |
| InChIKey | JMILGFYNSSLFRJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride?
The IUPAC name of methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride (CID 42614494) is methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride.
What is the SMILES notation for methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride?
The canonical SMILES for methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride is COC(=O)CC(N)c1ccccn1.Cl.Cl.
What is the InChIKey of methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride?
The InChIKey is JMILGFYNSSLFRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O2.2ClH/c1-13-9(12)6-7(10)8-4-2-3-5-11-8;;/h2-5,7H,6,10H2,1H3;2*1H.
What are the key properties of methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride?
methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride has a molecular weight of 253.13 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-amino-3-pyridin-2-ylpropanoate;dihydrochloride is sourced from PubChem (CID 42614494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).