About 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride
2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride (PubChem CID 42614571) has the molecular formula C6H10ClF3N2O
and a molecular weight of 218.61 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride.
Molecular Properties
| Compound Name | 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride |
| PubChem CID | 42614571 |
| Molecular Formula | C6H10ClF3N2O |
| Molecular Weight | 218.61 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride |
| SMILES | Cl.O=C(N[C@H]1CCNC1)C(F)(F)F |
| InChI | InChI=1S/C6H9F3N2O.ClH/c7-6(8,9)5(12)11-4-1-2-10-3-4;/h4,10H,1-3H2,(H,11,12);1H/t4-;/m0./s1 |
| InChIKey | CMZSIQCZAFAEDH-WCCKRBBISA-N |
| XLogP | 0.45 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.61 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride?
The IUPAC name of 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride (CID 42614571) is 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride.
What is the SMILES notation for 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride?
The canonical SMILES for 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride is Cl.O=C(N[C@H]1CCNC1)C(F)(F)F.
What is the InChIKey of 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride?
The InChIKey is CMZSIQCZAFAEDH-WCCKRBBISA-N. The full InChI is InChI=1S/C6H9F3N2O.ClH/c7-6(8,9)5(12)11-4-1-2-10-3-4;/h4,10H,1-3H2,(H,11,12);1H/t4-;/m0./s1.
What are the key properties of 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride?
2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride has a molecular weight of 218.61 g/mol, XLogP of 0.45, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trifluoro-N-[(3S)-pyrrolidin-3-yl]acetamide;hydrochloride is sourced from PubChem (CID 42614571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).