About 1-(benzylamino)-4,4,4-trifluorobutan-2-ol
1-(benzylamino)-4,4,4-trifluorobutan-2-ol (PubChem CID 42614690) has the molecular formula C11H14F3NO
and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-(benzylamino)-4,4,4-trifluorobutan-2-ol.
Molecular Properties
| Compound Name | 1-(benzylamino)-4,4,4-trifluorobutan-2-ol |
| PubChem CID | 42614690 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-(benzylamino)-4,4,4-trifluorobutan-2-ol |
| SMILES | OC(CNCc1ccccc1)CC(F)(F)F |
| InChI | InChI=1S/C11H14F3NO/c12-11(13,14)6-10(16)8-15-7-9-4-2-1-3-5-9/h1-5,10,15-16H,6-8H2 |
| InChIKey | FIPYXVWKZLCGAE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(benzylamino)-4,4,4-trifluorobutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzylamino)-4,4,4-trifluorobutan-2-ol?
The IUPAC name of 1-(benzylamino)-4,4,4-trifluorobutan-2-ol (CID 42614690) is 1-(benzylamino)-4,4,4-trifluorobutan-2-ol.
What is the SMILES notation for 1-(benzylamino)-4,4,4-trifluorobutan-2-ol?
The canonical SMILES for 1-(benzylamino)-4,4,4-trifluorobutan-2-ol is OC(CNCc1ccccc1)CC(F)(F)F.
What is the InChIKey of 1-(benzylamino)-4,4,4-trifluorobutan-2-ol?
The InChIKey is FIPYXVWKZLCGAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3NO/c12-11(13,14)6-10(16)8-15-7-9-4-2-1-3-5-9/h1-5,10,15-16H,6-8H2.
What are the key properties of 1-(benzylamino)-4,4,4-trifluorobutan-2-ol?
1-(benzylamino)-4,4,4-trifluorobutan-2-ol has a molecular weight of 233.23 g/mol, XLogP of 2.09, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzylamino)-4,4,4-trifluorobutan-2-ol is sourced from PubChem (CID 42614690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).