C10H10FNO — CID 42614788
4-fluoro-1,2,4,5-tetrahydro-2-benzazepin-3-one (PubChem CID 42614788) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 4-fluoro-1,2,4,5-tetrahydro-2-benzazepin-3-one.
| Compound Name | 4-fluoro-1,2,4,5-tetrahydro-2-benzazepin-3-one |
|---|---|
| PubChem CID | 42614788 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 4-fluoro-1,2,4,5-tetrahydro-2-benzazepin-3-one |
| SMILES | O=C1NCc2ccccc2CC1F |
| InChI | InChI=1S/C10H10FNO/c11-9-5-7-3-1-2-4-8(7)6-12-10(9)13/h1-4,9H,5-6H2,(H,12,13) |
| InChIKey | RSQRSDOZOCKJDS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |