C26H30N2O2S8+2 — CID 42615215
(15Z)-13,18-bis(methylsulfanyl)-8,23-dioxa-11,14,17,20,31,32-hexathia-5,26-diazoniapentacyclo[24.2.2.22,5.112,15.116,19]tetratriaconta-1(29),2(34),3,5(33),12,15,18,26(30),27-nonaene (PubChem CID 42615215) has the molecular formula C26H30N2O2S8+2 and a molecular weight of 659.07 g/mol. Its IUPAC name is (15Z)-13,18-bis(methylsulfanyl)-8,23-dioxa-11,14,17,20,31,32-hexathia-5,26-diazoniapentacyclo[24.2.2.22,5.112,15.116,19]tetratriaconta-1(29),2(34),3,5(33),12,15,18,26(30),27-nonaene.
| Compound Name | (15Z)-13,18-bis(methylsulfanyl)-8,23-dioxa-11,14,17,20,31,32-hexathia-5,26-diazoniapentacyclo[24.2.2.22,5.112,15.116,19]tetratriaconta-1(29),2(34),3,5(33),12,15,18,26(30),27-nonaene |
|---|---|
| PubChem CID | 42615215 |
| Molecular Formula | C26H30N2O2S8+2 |
| Molecular Weight | 659.07 g/mol |
| Exact Mass | 658.01 |
| IUPAC Name | (15Z)-13,18-bis(methylsulfanyl)-8,23-dioxa-11,14,17,20,31,32-hexathia-5,26-diazoniapentacyclo[24.2.2.22,5.112,15.116,19]tetratriaconta-1(29),2(34),3,5(33),12,15,18,26(30),27-nonaene |
| SMILES | CSC1=C2SCCOCC[n+]3ccc(cc3)-c3cc[n+](cc3)CCOCCSC3=C(SC)S/C(=C(\S1)S2)S3 |
| InChI | InChI=1S/C26H30N2O2S8/c1-31-21-23-33-17-15-29-13-11-27-7-3-19(4-8-27)20-5-9-28(10-6-20)12-14-30-16-18-34-24-22(32-2)36-26(38-24)25(35-21)37-23/h3-10H,11-18H2,1-2H3/q+2/b26-25- |
| InChIKey | CGIUDOSCUUBYFW-QPLCGJKRSA-N |
| XLogP | 7.51 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.07 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|