C21H21NO4 — CID 42618009
N-(2-methylpropyl)-2-oxo-7-phenylmethoxychromene-3-carboxamide (PubChem CID 42618009) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is N-(2-methylpropyl)-2-oxo-7-phenylmethoxychromene-3-carboxamide.
| Compound Name | N-(2-methylpropyl)-2-oxo-7-phenylmethoxychromene-3-carboxamide |
|---|---|
| PubChem CID | 42618009 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-(2-methylpropyl)-2-oxo-7-phenylmethoxychromene-3-carboxamide |
| SMILES | CC(C)CNC(=O)c1cc2ccc(OCc3ccccc3)cc2oc1=O |
| InChI | InChI=1S/C21H21NO4/c1-14(2)12-22-20(23)18-10-16-8-9-17(11-19(16)26-21(18)24)25-13-15-6-4-3-5-7-15/h3-11,14H,12-13H2,1-2H3,(H,22,23) |
| InChIKey | BHLPOOVJFYXSFF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|