About 6,8-dimethoxy-1,4-dimethylquinolin-2-one
6,8-dimethoxy-1,4-dimethylquinolin-2-one (PubChem CID 42618031) has the molecular formula C13H15NO3
and a molecular weight of 233.27 g/mol. Its IUPAC name is 6,8-dimethoxy-1,4-dimethylquinolin-2-one.
Molecular Properties
| Compound Name | 6,8-dimethoxy-1,4-dimethylquinolin-2-one |
| PubChem CID | 42618031 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 6,8-dimethoxy-1,4-dimethylquinolin-2-one |
| SMILES | COc1cc(OC)c2c(c1)c(C)cc(=O)n2C |
| InChI | InChI=1S/C13H15NO3/c1-8-5-12(15)14(2)13-10(8)6-9(16-3)7-11(13)17-4/h5-7H,1-4H3 |
| InChIKey | BYYQQWLTZFBHIQ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,8-dimethoxy-1,4-dimethylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,8-dimethoxy-1,4-dimethylquinolin-2-one?
The IUPAC name of 6,8-dimethoxy-1,4-dimethylquinolin-2-one (CID 42618031) is 6,8-dimethoxy-1,4-dimethylquinolin-2-one.
What is the SMILES notation for 6,8-dimethoxy-1,4-dimethylquinolin-2-one?
The canonical SMILES for 6,8-dimethoxy-1,4-dimethylquinolin-2-one is COc1cc(OC)c2c(c1)c(C)cc(=O)n2C.
What is the InChIKey of 6,8-dimethoxy-1,4-dimethylquinolin-2-one?
The InChIKey is BYYQQWLTZFBHIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO3/c1-8-5-12(15)14(2)13-10(8)6-9(16-3)7-11(13)17-4/h5-7H,1-4H3.
What are the key properties of 6,8-dimethoxy-1,4-dimethylquinolin-2-one?
6,8-dimethoxy-1,4-dimethylquinolin-2-one has a molecular weight of 233.27 g/mol, XLogP of 1.86, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethoxy-1,4-dimethylquinolin-2-one is sourced from PubChem (CID 42618031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).