C14H17NO5 — CID 42618034
5,6,7,8-tetramethoxy-4-methyl-1H-quinolin-2-one (PubChem CID 42618034) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 5,6,7,8-tetramethoxy-4-methyl-1H-quinolin-2-one.
| Compound Name | 5,6,7,8-tetramethoxy-4-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 42618034 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 5,6,7,8-tetramethoxy-4-methyl-1H-quinolin-2-one |
| SMILES | COc1c(OC)c(OC)c2c(C)cc(=O)[nH]c2c1OC |
| InChI | InChI=1S/C14H17NO5/c1-7-6-8(16)15-10-9(7)11(17-2)13(19-4)14(20-5)12(10)18-3/h6H,1-5H3,(H,15,16) |
| InChIKey | UWSNOYGRNSLKPY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 69.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |