C12H6FN5O3S3 — CID 42618083
4-fluoro-N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 42618083) has the molecular formula C12H6FN5O3S3 and a molecular weight of 383.41 g/mol. Its IUPAC name is 4-fluoro-N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 4-fluoro-N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 42618083 |
| Molecular Formula | C12H6FN5O3S3 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 382.96 |
| IUPAC Name | 4-fluoro-N-[5-[(5-nitro-1,3-thiazol-2-yl)sulfanyl]-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(Sc2ncc([N+](=O)[O-])s2)s1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H6FN5O3S3/c13-7-3-1-6(2-4-7)9(19)15-10-16-17-12(23-10)24-11-14-5-8(22-11)18(20)21/h1-5H,(H,15,16,19) |
| InChIKey | ZJEVWLAYMWZYNB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 110.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|