C20H35N3O2 — CID 42618131
(2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]-N-(cyclohexylmethyl)pyrrolidine-2-carboxamide (PubChem CID 42618131) has the molecular formula C20H35N3O2 and a molecular weight of 349.52 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]-N-(cyclohexylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]-N-(cyclohexylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 42618131 |
| Molecular Formula | C20H35N3O2 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.27 |
| IUPAC Name | (2S)-1-[(2R)-2-amino-2-cyclohexylacetyl]-N-(cyclohexylmethyl)pyrrolidine-2-carboxamide |
| SMILES | N[C@@H](C(=O)N1CCC[C@H]1C(=O)NCC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C20H35N3O2/c21-18(16-10-5-2-6-11-16)20(25)23-13-7-12-17(23)19(24)22-14-15-8-3-1-4-9-15/h15-18H,1-14,21H2,(H,22,24)/t17-,18+/m0/s1 |
| InChIKey | WDGNJJXTBINLSY-ZWKOTPCHSA-N |
| XLogP | 2.58 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |