C21H24N4O2 — CID 42618138
ethyl 5-amino-2-methyl-4-pyridin-4-yl-1,4,6,7,8,9-hexahydrobenzo[b][1,8]naphthyridine-3-carboxylate (PubChem CID 42618138) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is ethyl 5-amino-2-methyl-4-pyridin-4-yl-1,4,6,7,8,9-hexahydrobenzo[b][1,8]naphthyridine-3-carboxylate.
| Compound Name | ethyl 5-amino-2-methyl-4-pyridin-4-yl-1,4,6,7,8,9-hexahydrobenzo[b][1,8]naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 42618138 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | ethyl 5-amino-2-methyl-4-pyridin-4-yl-1,4,6,7,8,9-hexahydrobenzo[b][1,8]naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=C(C)Nc2nc3c(c(N)c2C1c1ccncc1)CCCC3 |
| InChI | InChI=1S/C21H24N4O2/c1-3-27-21(26)16-12(2)24-20-18(17(16)13-8-10-23-11-9-13)19(22)14-6-4-5-7-15(14)25-20/h8-11,17H,3-7H2,1-2H3,(H3,22,24,25) |
| InChIKey | JYCNMGJHVNKCCF-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |