C21H23N3O3S — CID 42618156
4-[7-(piperidin-3-ylmethoxy)isoquinolin-6-yl]benzenesulfonamide (PubChem CID 42618156) has the molecular formula C21H23N3O3S and a molecular weight of 397.50 g/mol. Its IUPAC name is 4-[7-(piperidin-3-ylmethoxy)isoquinolin-6-yl]benzenesulfonamide.
| Compound Name | 4-[7-(piperidin-3-ylmethoxy)isoquinolin-6-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 42618156 |
| Molecular Formula | C21H23N3O3S |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | 4-[7-(piperidin-3-ylmethoxy)isoquinolin-6-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(-c2cc3ccncc3cc2OCC2CCCNC2)cc1 |
| InChI | InChI=1S/C21H23N3O3S/c22-28(25,26)19-5-3-16(4-6-19)20-10-17-7-9-24-13-18(17)11-21(20)27-14-15-2-1-8-23-12-15/h3-7,9-11,13,15,23H,1-2,8,12,14H2,(H2,22,25,26) |
| InChIKey | YYCVMZMWSRQJQI-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |