C22H31N5O2 — CID 42618182
8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 42618182) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 42618182 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-dipropylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCCN(CCC)c1nc(C)nc2c(-c3c(C)cc(OC)cc3OC)c(C)nn12 |
| InChI | InChI=1S/C22H31N5O2/c1-8-10-26(11-9-2)22-24-16(5)23-21-20(15(4)25-27(21)22)19-14(3)12-17(28-6)13-18(19)29-7/h12-13H,8-11H2,1-7H3 |
| InChIKey | FGLAGWQPEAMLIC-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |