C22H27N5O2 — CID 42618183
8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-bis(prop-2-enyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 42618183) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-bis(prop-2-enyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-bis(prop-2-enyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 42618183 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 8-(2,4-dimethoxy-6-methylphenyl)-2,7-dimethyl-N,N-bis(prop-2-enyl)pyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | C=CCN(CC=C)c1nc(C)nc2c(-c3c(C)cc(OC)cc3OC)c(C)nn12 |
| InChI | InChI=1S/C22H27N5O2/c1-8-10-26(11-9-2)22-24-16(5)23-21-20(15(4)25-27(21)22)19-14(3)12-17(28-6)13-18(19)29-7/h8-9,12-13H,1-2,10-11H2,3-7H3 |
| InChIKey | GOJIGPCJYHJBBF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|