C20H25N5O2 — CID 42618186
8-(2,4-dimethoxy-6-methylphenyl)-N,2,7-trimethyl-N-prop-2-enylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 42618186) has the molecular formula C20H25N5O2 and a molecular weight of 367.45 g/mol. Its IUPAC name is 8-(2,4-dimethoxy-6-methylphenyl)-N,2,7-trimethyl-N-prop-2-enylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(2,4-dimethoxy-6-methylphenyl)-N,2,7-trimethyl-N-prop-2-enylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 42618186 |
| Molecular Formula | C20H25N5O2 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.20 |
| IUPAC Name | 8-(2,4-dimethoxy-6-methylphenyl)-N,2,7-trimethyl-N-prop-2-enylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | C=CCN(C)c1nc(C)nc2c(-c3c(C)cc(OC)cc3OC)c(C)nn12 |
| InChI | InChI=1S/C20H25N5O2/c1-8-9-24(5)20-22-14(4)21-19-18(13(3)23-25(19)20)17-12(2)10-15(26-6)11-16(17)27-7/h8,10-11H,1,9H2,2-7H3 |
| InChIKey | QUKQYNSOWIXXCA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|