C22H31N5O4 — CID 42618190
8-(2,4-dimethoxy-6-methylphenyl)-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 42618190) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is 8-(2,4-dimethoxy-6-methylphenyl)-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-(2,4-dimethoxy-6-methylphenyl)-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 42618190 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | 8-(2,4-dimethoxy-6-methylphenyl)-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | COCCN(CCOC)c1nc(C)nc2c(-c3c(C)cc(OC)cc3OC)c(C)nn12 |
| InChI | InChI=1S/C22H31N5O4/c1-14-12-17(30-6)13-18(31-7)19(14)20-15(2)25-27-21(20)23-16(3)24-22(27)26(8-10-28-4)9-11-29-5/h12-13H,8-11H2,1-7H3 |
| InChIKey | NRMNQHPJRGSLDF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |