C21H29N5O — CID 42618194
N-butyl-8-(4-methoxy-2,6-dimethylphenyl)-N,2,7-trimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 42618194) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is N-butyl-8-(4-methoxy-2,6-dimethylphenyl)-N,2,7-trimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | N-butyl-8-(4-methoxy-2,6-dimethylphenyl)-N,2,7-trimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 42618194 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | N-butyl-8-(4-methoxy-2,6-dimethylphenyl)-N,2,7-trimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCCCN(C)c1nc(C)nc2c(-c3c(C)cc(OC)cc3C)c(C)nn12 |
| InChI | InChI=1S/C21H29N5O/c1-8-9-10-25(6)21-23-16(5)22-20-19(15(4)24-26(20)21)18-13(2)11-17(27-7)12-14(18)3/h11-12H,8-10H2,1-7H3 |
| InChIKey | HYMFVRVVSVXOCZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |