C22H33N7O2 — CID 42618209
8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 42618209) has the molecular formula C22H33N7O2 and a molecular weight of 427.55 g/mol. Its IUPAC name is 8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 42618209 |
| Molecular Formula | C22H33N7O2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.27 |
| IUPAC Name | 8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-bis(2-methoxyethyl)-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | COCCN(CCOC)c1nc(C)nc2c(-c3c(C)cc(N(C)C)nc3C)c(C)nn12 |
| InChI | InChI=1S/C22H33N7O2/c1-14-13-18(27(5)6)23-15(2)19(14)20-16(3)26-29-21(20)24-17(4)25-22(29)28(9-11-30-7)10-12-31-8/h13H,9-12H2,1-8H3 |
| InChIKey | YAPODPFTTIJBTD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |