C20H29N7 — CID 42618210
8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-diethyl-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 42618210) has the molecular formula C20H29N7 and a molecular weight of 367.50 g/mol. Its IUPAC name is 8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-diethyl-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-diethyl-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 42618210 |
| Molecular Formula | C20H29N7 |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | 8-[6-(dimethylamino)-2,4-dimethyl-3-pyridinyl]-N,N-diethyl-2,7-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCN(CC)c1nc(C)nc2c(-c3c(C)cc(N(C)C)nc3C)c(C)nn12 |
| InChI | InChI=1S/C20H29N7/c1-9-26(10-2)20-23-15(6)22-19-18(14(5)24-27(19)20)17-12(3)11-16(25(7)8)21-13(17)4/h11H,9-10H2,1-8H3 |
| InChIKey | GEVYBKIWECOTKX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |