C15H10O5 — CID 42618237
(11R,15R)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione (PubChem CID 42618237) has the molecular formula C15H10O5 and a molecular weight of 270.24 g/mol. Its IUPAC name is (11R,15R)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione.
| Compound Name | (11R,15R)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
|---|---|
| PubChem CID | 42618237 |
| Molecular Formula | C15H10O5 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.05 |
| IUPAC Name | (11R,15R)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
| SMILES | O=C1C[C@H]2OCC3=C(C(=O)c4ccccc4C3=O)[C@H]2O1 |
| InChI | InChI=1S/C15H10O5/c16-11-5-10-15(20-11)12-9(6-19-10)13(17)7-3-1-2-4-8(7)14(12)18/h1-4,10,15H,5-6H2/t10-,15+/m1/s1 |
| InChIKey | PQYMSDMYIOKZDF-BMIGLBTASA-N |
| XLogP | 1.08 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|