C21H14O6 — CID 42618240
(11R,15R,17S)-17-(4-hydroxyphenyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione (PubChem CID 42618240) has the molecular formula C21H14O6 and a molecular weight of 362.34 g/mol. Its IUPAC name is (11R,15R,17S)-17-(4-hydroxyphenyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione.
| Compound Name | (11R,15R,17S)-17-(4-hydroxyphenyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
|---|---|
| PubChem CID | 42618240 |
| Molecular Formula | C21H14O6 |
| Molecular Weight | 362.34 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (11R,15R,17S)-17-(4-hydroxyphenyl)-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
| SMILES | O=C1C[C@H]2O[C@@H](c3ccc(O)cc3)C3=C(C(=O)c4ccccc4C3=O)[C@H]2O1 |
| InChI | InChI=1S/C21H14O6/c22-11-7-5-10(6-8-11)20-16-17(21-14(26-20)9-15(23)27-21)19(25)13-4-2-1-3-12(13)18(16)24/h1-8,14,20-22H,9H2/t14-,20+,21+/m1/s1 |
| InChIKey | GPKTXVNBWXOGHI-OREJSRFESA-N |
| XLogP | 2.52 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|