C17H14O5 — CID 42618247
(11R,15R)-17,17-dimethyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione (PubChem CID 42618247) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is (11R,15R)-17,17-dimethyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione.
| Compound Name | (11R,15R)-17,17-dimethyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
|---|---|
| PubChem CID | 42618247 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | (11R,15R)-17,17-dimethyl-12,16-dioxatetracyclo[8.7.0.03,8.011,15]heptadeca-1(10),3,5,7-tetraene-2,9,13-trione |
| SMILES | CC1(C)O[C@@H]2CC(=O)O[C@@H]2C2=C1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C17H14O5/c1-17(2)13-12(16-10(22-17)7-11(18)21-16)14(19)8-5-3-4-6-9(8)15(13)20/h3-6,10,16H,7H2,1-2H3/t10-,16+/m1/s1 |
| InChIKey | YNQWJSGTQYKNOA-HWPZZCPQSA-N |
| XLogP | 1.86 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|