C19H24F3N3O2 — CID 42618268
1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-2,5-dione (PubChem CID 42618268) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is 1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 42618268 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]butyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1CCCCN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H24F3N3O2/c20-19(21,22)15-4-3-5-16(14-15)24-12-10-23(11-13-24)8-1-2-9-25-17(26)6-7-18(25)27/h3-5,14H,1-2,6-13H2 |
| InChIKey | PEQJTCZGJSKPGE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|