C25H30F3N3O2 — CID 42618273
2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 42618273) has the molecular formula C25H30F3N3O2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | 2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 42618273 |
| Molecular Formula | C25H30F3N3O2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | 2-[4-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]cyclohexyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1C2CC=CCC2C(=O)N1C1CCC(N2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C25H30F3N3O2/c26-25(27,28)17-4-3-5-20(16-17)30-14-12-29(13-15-30)18-8-10-19(11-9-18)31-23(32)21-6-1-2-7-22(21)24(31)33/h1-5,16,18-19,21-22H,6-15H2 |
| InChIKey | OBKXULMELCPTCP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|