C25H41NO8 — CID 42619757
(2S,3S,4S,5R,6S,8R,9R,13S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9-triol (PubChem CID 42619757) has the molecular formula C25H41NO8 and a molecular weight of 483.60 g/mol. Its IUPAC name is (2S,3S,4S,5R,6S,8R,9R,13S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9-triol.
| Compound Name | (2S,3S,4S,5R,6S,8R,9R,13S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9-triol |
|---|---|
| PubChem CID | 42619757 |
| Molecular Formula | C25H41NO8 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (2S,3S,4S,5R,6S,8R,9R,13S,17R,18S)-11-ethyl-13-(hydroxymethyl)-4,6,16,18-tetramethoxy-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-2,8,9-triol |
| SMILES | CCN1C[C@]2(CO)CCC(OC)C34C1[C@@](O)([C@@H](OC)[C@@H]32)[C@@]1(O)C[C@H](OC)[C@H]2C[C@]4(O)[C@@H]1[C@H]2OC |
| InChI | InChI=1S/C25H41NO8/c1-6-26-11-21(12-27)8-7-15(32-3)24-18(21)19(34-5)25(30,20(24)26)23(29)10-14(31-2)13-9-22(24,28)17(23)16(13)33-4/h13-20,27-30H,6-12H2,1-5H3/t13-,14+,15?,16+,17+,18-,19+,20?,21+,22+,23-,24?,25+/m1/s1 |
| InChIKey | OENTVFFHLKZTAK-WVOKXWLFSA-N |
| XLogP | -0.61 |
| TPSA | 121.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |