C41H65F6NO2 — CID 42621635
(11S,17S)-7-[5-butyl-10-[methyl(8,8,9,9,9-pentafluorononyl)amino]decyl]-11-fluoro-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 42621635) has the molecular formula C41H65F6NO2 and a molecular weight of 717.96 g/mol. Its IUPAC name is (11S,17S)-7-[5-butyl-10-[methyl(8,8,9,9,9-pentafluorononyl)amino]decyl]-11-fluoro-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (11S,17S)-7-[5-butyl-10-[methyl(8,8,9,9,9-pentafluorononyl)amino]decyl]-11-fluoro-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 42621635 |
| Molecular Formula | C41H65F6NO2 |
| Molecular Weight | 717.96 g/mol |
| Exact Mass | 717.49 |
| IUPAC Name | (11S,17S)-7-[5-butyl-10-[methyl(8,8,9,9,9-pentafluorononyl)amino]decyl]-11-fluoro-7,8,9,11,12,13,14,15,16,17-decahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CCCCC(CCCCCN(C)CCCCCCCC(F)(F)C(F)(F)F)CCCCC1Cc2cc(O)ccc2C2C1C1CC[C@H](O)C1C[C@@H]2F |
| InChI | InChI=1S/C41H65F6NO2/c1-3-4-15-29(16-9-8-14-25-48(2)24-13-7-5-6-12-23-40(43,44)41(45,46)47)17-10-11-18-30-26-31-27-32(49)19-20-33(31)39-36(42)28-35-34(38(30)39)21-22-37(35)50/h19-20,27,29-30,34-39,49-50H,3-18,21-26,28H2,1-2H3/t29?,30?,34?,35?,36-,37-,38?,39?/m0/s1 |
| InChIKey | KTOFVLSHMNIRNW-SZMJTOEFSA-N |
| XLogP | 11.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.96 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|