About 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide
10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide (PubChem CID 42623047) has the molecular formula C18H15F3N2O2
and a molecular weight of 348.32 g/mol. Its IUPAC name is 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide.
Molecular Properties
| Compound Name | 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide |
| PubChem CID | 42623047 |
| Molecular Formula | C18H15F3N2O2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide |
| SMILES | CCCCn1c2ccccc2c(=O)c2c(F)c(C(N)=O)c(F)c(F)c21 |
| InChI | InChI=1S/C18H15F3N2O2/c1-2-3-8-23-10-7-5-4-6-9(10)17(24)12-13(19)11(18(22)25)14(20)15(21)16(12)23/h4-7H,2-3,8H2,1H3,(H2,22,25) |
| InChIKey | GSVPZXXGGYCWQP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide?
The IUPAC name of 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide (CID 42623047) is 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide.
What is the SMILES notation for 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide?
The canonical SMILES for 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide is CCCCn1c2ccccc2c(=O)c2c(F)c(C(N)=O)c(F)c(F)c21.
What is the InChIKey of 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide?
The InChIKey is GSVPZXXGGYCWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15F3N2O2/c1-2-3-8-23-10-7-5-4-6-9(10)17(24)12-13(19)11(18(22)25)14(20)15(21)16(12)23/h4-7H,2-3,8H2,1H3,(H2,22,25).
What are the key properties of 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide?
10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide has a molecular weight of 348.32 g/mol, XLogP of 3.47, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-butyl-1,3,4-trifluoro-9-oxoacridine-2-carboxamide is sourced from PubChem (CID 42623047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).