C18H17N5O3 — CID 42623172
3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-5-methyl-1,2,4-oxadiazole (PubChem CID 42623172) has the molecular formula C18H17N5O3 and a molecular weight of 351.37 g/mol. Its IUPAC name is 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-5-methyl-1,2,4-oxadiazole.
| Compound Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-5-methyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 42623172 |
| Molecular Formula | C18H17N5O3 |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-5-methyl-1,2,4-oxadiazole |
| SMILES | COCCOc1cc(-c2cn3ncccc3n2)cc(-c2noc(C)n2)c1 |
| InChI | InChI=1S/C18H17N5O3/c1-12-20-18(22-26-12)14-8-13(9-15(10-14)25-7-6-24-2)16-11-23-17(21-16)4-3-5-19-23/h3-5,8-11H,6-7H2,1-2H3 |
| InChIKey | SZROAHNZSADXEY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|