C21H24F2N4O2 — CID 42623209
2-(2,4-difluorophenyl)-1-[methyl(3-phenoxypropyl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol (PubChem CID 42623209) has the molecular formula C21H24F2N4O2 and a molecular weight of 402.45 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1-[methyl(3-phenoxypropyl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol.
| Compound Name | 2-(2,4-difluorophenyl)-1-[methyl(3-phenoxypropyl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 42623209 |
| Molecular Formula | C21H24F2N4O2 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1-[methyl(3-phenoxypropyl)amino]-3-(1,2,4-triazol-1-yl)propan-2-ol |
| SMILES | CN(CCCOc1ccccc1)CC(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C21H24F2N4O2/c1-26(10-5-11-29-18-6-3-2-4-7-18)13-21(28,14-27-16-24-15-25-27)19-9-8-17(22)12-20(19)23/h2-4,6-9,12,15-16,28H,5,10-11,13-14H2,1H3 |
| InChIKey | UTGCTGKRHMFEBQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|