C20H17F3N6O4 — CID 42623339
3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 42623339) has the molecular formula C20H17F3N6O4 and a molecular weight of 462.39 g/mol. Its IUPAC name is 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 42623339 |
| Molecular Formula | C20H17F3N6O4 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.13 |
| IUPAC Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-(2,2,2-trifluoroethyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COCCOc1cc(-c2cn3ncccc3n2)cc(-c2noc(C(=O)NCC(F)(F)F)n2)c1 |
| InChI | InChI=1S/C20H17F3N6O4/c1-31-5-6-32-14-8-12(15-10-29-16(26-15)3-2-4-25-29)7-13(9-14)17-27-19(33-28-17)18(30)24-11-20(21,22)23/h2-4,7-10H,5-6,11H2,1H3,(H,24,30) |
| InChIKey | AKNJHOUGTCCDSA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|