C18H16N6O4 — CID 42623422
3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 42623422) has the molecular formula C18H16N6O4 and a molecular weight of 380.36 g/mol. Its IUPAC name is 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 42623422 |
| Molecular Formula | C18H16N6O4 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COCCOc1cc(-c2cn3ncccc3n2)cc(-c2noc(C(N)=O)n2)c1 |
| InChI | InChI=1S/C18H16N6O4/c1-26-5-6-27-13-8-11(14-10-24-15(21-14)3-2-4-20-24)7-12(9-13)17-22-18(16(19)25)28-23-17/h2-4,7-10H,5-6H2,1H3,(H2,19,25) |
| InChIKey | RYPRUBNQCXNMJF-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 130.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|