C18H15N5O5 — CID 42623423
3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxylic acid (PubChem CID 42623423) has the molecular formula C18H15N5O5 and a molecular weight of 381.35 g/mol. Its IUPAC name is 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxylic acid.
| Compound Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 42623423 |
| Molecular Formula | C18H15N5O5 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole-5-carboxylic acid |
| SMILES | COCCOc1cc(-c2cn3ncccc3n2)cc(-c2noc(C(=O)O)n2)c1 |
| InChI | InChI=1S/C18H15N5O5/c1-26-5-6-27-13-8-11(14-10-23-15(20-14)3-2-4-19-23)7-12(9-13)16-21-17(18(24)25)28-22-16/h2-4,7-10H,5-6H2,1H3,(H,24,25) |
| InChIKey | YYUWLYIBMVXGOY-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 124.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|