C18H17N5O4 — CID 42623424
[3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methanol (PubChem CID 42623424) has the molecular formula C18H17N5O4 and a molecular weight of 367.37 g/mol. Its IUPAC name is [3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methanol.
| Compound Name | [3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methanol |
|---|---|
| PubChem CID | 42623424 |
| Molecular Formula | C18H17N5O4 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | [3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazol-5-yl]methanol |
| SMILES | COCCOc1cc(-c2cn3ncccc3n2)cc(-c2noc(CO)n2)c1 |
| InChI | InChI=1S/C18H17N5O4/c1-25-5-6-26-14-8-12(15-10-23-16(20-15)3-2-4-19-23)7-13(9-14)18-21-17(11-24)27-22-18/h2-4,7-10,24H,5-6,11H2,1H3 |
| InChIKey | HEGUKUBMSVANSO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|