C20H21N5O4 — CID 42623425
5-(ethoxymethyl)-3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole (PubChem CID 42623425) has the molecular formula C20H21N5O4 and a molecular weight of 395.42 g/mol. Its IUPAC name is 5-(ethoxymethyl)-3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-(ethoxymethyl)-3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 42623425 |
| Molecular Formula | C20H21N5O4 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 5-(ethoxymethyl)-3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-1,2,4-oxadiazole |
| SMILES | CCOCc1nc(-c2cc(OCCOC)cc(-c3cn4ncccc4n3)c2)no1 |
| InChI | InChI=1S/C20H21N5O4/c1-3-27-13-19-23-20(24-29-19)15-9-14(10-16(11-15)28-8-7-26-2)17-12-25-18(22-17)5-4-6-21-25/h4-6,9-12H,3,7-8,13H2,1-2H3 |
| InChIKey | CUNUPDZFTBJWHW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 96.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|