C23H19N7O4 — CID 42623505
3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-pyridin-2-yl-1,2,4-oxadiazole-5-carboxamide (PubChem CID 42623505) has the molecular formula C23H19N7O4 and a molecular weight of 457.45 g/mol. Its IUPAC name is 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-pyridin-2-yl-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-pyridin-2-yl-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 42623505 |
| Molecular Formula | C23H19N7O4 |
| Molecular Weight | 457.45 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | 3-[3-imidazo[1,2-b]pyridazin-2-yl-5-(2-methoxyethoxy)phenyl]-N-pyridin-2-yl-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COCCOc1cc(-c2cn3ncccc3n2)cc(-c2noc(C(=O)Nc3ccccn3)n2)c1 |
| InChI | InChI=1S/C23H19N7O4/c1-32-9-10-33-17-12-15(18-14-30-20(26-18)6-4-8-25-30)11-16(13-17)21-28-23(34-29-21)22(31)27-19-5-2-3-7-24-19/h2-8,11-14H,9-10H2,1H3,(H,24,27,31) |
| InChIKey | ZSWASTFTCOIAQY-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|